C19H17NS — CID 134693405
6-benzyl-5-phenyl-2,4-dihydrothieno[2,3-c]pyrrole (PubChem CID 134693405) has the molecular formula C19H17NS and a molecular weight of 291.42 g/mol. Its IUPAC name is 6-benzyl-5-phenyl-2,4-dihydrothieno[2,3-c]pyrrole.
| Compound Name | 6-benzyl-5-phenyl-2,4-dihydrothieno[2,3-c]pyrrole |
|---|---|
| PubChem CID | 134693405 |
| Molecular Formula | C19H17NS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 6-benzyl-5-phenyl-2,4-dihydrothieno[2,3-c]pyrrole |
| SMILES | C1=C2CN(c3ccccc3)C(Cc3ccccc3)=C2SC1 |
| InChI | InChI=1S/C19H17NS/c1-3-7-15(8-4-1)13-18-19-16(11-12-21-19)14-20(18)17-9-5-2-6-10-17/h1-11H,12-14H2 |
| InChIKey | ICLLPDKIHXJQNG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |