C17H16FN — CID 134863082
5-fluoro-1,4-diphenyl-3,6-dihydro-2H-pyridine (PubChem CID 134863082) has the molecular formula C17H16FN and a molecular weight of 253.32 g/mol. Its IUPAC name is 5-fluoro-1,4-diphenyl-3,6-dihydro-2H-pyridine.
| Compound Name | 5-fluoro-1,4-diphenyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 134863082 |
| Molecular Formula | C17H16FN |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-fluoro-1,4-diphenyl-3,6-dihydro-2H-pyridine |
| SMILES | FC1=C(c2ccccc2)CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C17H16FN/c18-17-13-19(15-9-5-2-6-10-15)12-11-16(17)14-7-3-1-4-8-14/h1-10H,11-13H2 |
| InChIKey | QWENUWWCJHIYAP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |