C35H38F2N8 — CID 134693614
6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]pentan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole (PubChem CID 134693614) has the molecular formula C35H38F2N8 and a molecular weight of 608.74 g/mol. Its IUPAC name is 6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]pentan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]pentan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 134693614 |
| Molecular Formula | C35H38F2N8 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | 6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]pentan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole |
| SMILES | CCCC(Cn1cc(Cn2c3c(c4cc(F)ccc42)CCCC3)nn1)n1cc(Cn2c3c(c4cc(F)ccc42)CCCC3)nn1 |
| InChI | InChI=1S/C35H38F2N8/c1-2-7-27(45-21-26(39-41-45)20-44-33-11-6-4-9-29(33)31-17-24(37)13-15-35(31)44)22-42-18-25(38-40-42)19-43-32-10-5-3-8-28(32)30-16-23(36)12-14-34(30)43/h12-18,21,27H,2-11,19-20,22H2,1H3 |
| InChIKey | UIIGAJSVASLFHI-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|