C36H40F2N8 — CID 134693617
6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]hexan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole (PubChem CID 134693617) has the molecular formula C36H40F2N8 and a molecular weight of 622.77 g/mol. Its IUPAC name is 6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]hexan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole.
| Compound Name | 6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]hexan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 134693617 |
| Molecular Formula | C36H40F2N8 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | 6-fluoro-9-[[1-[1-[4-[(6-fluoro-1,2,3,4-tetrahydrocarbazol-9-yl)methyl]triazol-1-yl]hexan-2-yl]triazol-4-yl]methyl]-1,2,3,4-tetrahydrocarbazole |
| SMILES | CCCCC(Cn1cc(Cn2c3c(c4cc(F)ccc42)CCCC3)nn1)n1cc(Cn2c3c(c4cc(F)ccc42)CCCC3)nn1 |
| InChI | InChI=1S/C36H40F2N8/c1-2-3-8-28(46-22-27(40-42-46)21-45-34-12-7-5-10-30(34)32-18-25(38)14-16-36(32)45)23-43-19-26(39-41-43)20-44-33-11-6-4-9-29(33)31-17-24(37)13-15-35(31)44/h13-19,22,28H,2-12,20-21,23H2,1H3 |
| InChIKey | ZCFSKWIJGOTUFC-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 71.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|