C13H15ClN4O2 — CID 13469399
2-chloro-N-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]propanamide (PubChem CID 13469399) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-chloro-N-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]propanamide.
| Compound Name | 2-chloro-N-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 13469399 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-chloro-N-[4-(5-methyl-3-oxo-4,5-dihydro-2H-1,2,4-triazin-6-yl)phenyl]propanamide |
| SMILES | CC(Cl)C(=O)Nc1ccc(C2=NNC(=O)NC2C)cc1 |
| InChI | InChI=1S/C13H15ClN4O2/c1-7(14)12(19)16-10-5-3-9(4-6-10)11-8(2)15-13(20)18-17-11/h3-8H,1-2H3,(H,16,19)(H2,15,18,20) |
| InChIKey | IWSAYFHYFDJKJR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|