C20H26N2O3 — CID 134695884
4-methyl-3-[[[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]acetyl]amino]methyl]benzoic acid (PubChem CID 134695884) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-methyl-3-[[[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]acetyl]amino]methyl]benzoic acid.
| Compound Name | 4-methyl-3-[[[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]acetyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134695884 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-methyl-3-[[[2-[(2R,6R)-6-methyl-2-prop-2-enyl-3,6-dihydro-2H-pyridin-1-yl]acetyl]amino]methyl]benzoic acid |
| SMILES | C=CC[C@@H]1CC=C[C@@H](C)N1CC(=O)NCc1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C20H26N2O3/c1-4-6-18-8-5-7-15(3)22(18)13-19(23)21-12-17-11-16(20(24)25)10-9-14(17)2/h4-5,7,9-11,15,18H,1,6,8,12-13H2,2-3H3,(H,21,23)(H,24,25)/t15-,18-/m1/s1 |
| InChIKey | WAFGZKROGOHAHU-CRAIPNDOSA-N |
| XLogP | 2.90 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|