C15H27NO3S — CID 13469597
tert-butyl 2-[cyclopentyl-(2-methyl-3-sulfanylpropanoyl)amino]acetate (PubChem CID 13469597) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is tert-butyl 2-[cyclopentyl-(2-methyl-3-sulfanylpropanoyl)amino]acetate.
| Compound Name | tert-butyl 2-[cyclopentyl-(2-methyl-3-sulfanylpropanoyl)amino]acetate |
|---|---|
| PubChem CID | 13469597 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | tert-butyl 2-[cyclopentyl-(2-methyl-3-sulfanylpropanoyl)amino]acetate |
| SMILES | CC(CS)C(=O)N(CC(=O)OC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C15H27NO3S/c1-11(10-20)14(18)16(12-7-5-6-8-12)9-13(17)19-15(2,3)4/h11-12,20H,5-10H2,1-4H3 |
| InChIKey | QGOJRTMTQFHYOS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|