C25H46N2O3S — CID 54580807
2-[cycloheptyl-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid;N-cyclohexylcyclohexanamine (PubChem CID 54580807) has the molecular formula C25H46N2O3S and a molecular weight of 454.72 g/mol. Its IUPAC name is 2-[cycloheptyl-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid;N-cyclohexylcyclohexanamine.
| Compound Name | 2-[cycloheptyl-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid;N-cyclohexylcyclohexanamine |
|---|---|
| PubChem CID | 54580807 |
| Molecular Formula | C25H46N2O3S |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | 2-[cycloheptyl-(2-methyl-3-sulfanylpropanoyl)amino]acetic acid;N-cyclohexylcyclohexanamine |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(CS)C(=O)N(CC(=O)O)C1CCCCCC1 |
| InChI | InChI=1S/C13H23NO3S.C12H23N/c1-10(9-18)13(17)14(8-12(15)16)11-6-4-2-3-5-7-11;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h10-11,18H,2-9H2,1H3,(H,15,16);11-13H,1-10H2 |
| InChIKey | OZBVFCXSWGCMTF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|