C19H29NO3 — CID 134697649
(3S,4R)-4-(hydroxymethyl)-1-[(3-prop-2-enoxyphenyl)methyl]-4-propylpiperidin-3-ol (PubChem CID 134697649) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is (3S,4R)-4-(hydroxymethyl)-1-[(3-prop-2-enoxyphenyl)methyl]-4-propylpiperidin-3-ol.
| Compound Name | (3S,4R)-4-(hydroxymethyl)-1-[(3-prop-2-enoxyphenyl)methyl]-4-propylpiperidin-3-ol |
|---|---|
| PubChem CID | 134697649 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (3S,4R)-4-(hydroxymethyl)-1-[(3-prop-2-enoxyphenyl)methyl]-4-propylpiperidin-3-ol |
| SMILES | C=CCOc1cccc(CN2CC[C@@](CO)(CCC)[C@H](O)C2)c1 |
| InChI | InChI=1S/C19H29NO3/c1-3-8-19(15-21)9-10-20(14-18(19)22)13-16-6-5-7-17(12-16)23-11-4-2/h4-7,12,18,21-22H,2-3,8-11,13-15H2,1H3/t18-,19-/m1/s1 |
| InChIKey | NDNLTMSHAUXGRK-RTBURBONSA-N |
| XLogP | 2.60 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|