C8H10N2O — CID 13469993
3-amino-1,4,5,6-tetrahydroindol-2-one (PubChem CID 13469993) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 3-amino-1,4,5,6-tetrahydroindol-2-one.
| Compound Name | 3-amino-1,4,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 13469993 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 3-amino-1,4,5,6-tetrahydroindol-2-one |
| SMILES | NC1=C2CCCC=C2NC1=O |
| InChI | InChI=1S/C8H10N2O/c9-7-5-3-1-2-4-6(5)10-8(7)11/h4H,1-3,9H2,(H,10,11) |
| InChIKey | FMMICURWXOBLES-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |