C20H26N2O3 — CID 134702962
N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-4-(2-oxopyrrolidin-1-yl)benzamide (PubChem CID 134702962) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-4-(2-oxopyrrolidin-1-yl)benzamide.
| Compound Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-4-(2-oxopyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 134702962 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N-methyl-4-(2-oxopyrrolidin-1-yl)benzamide |
| SMILES | CN(C(=O)c1ccc(N2CCCC2=O)cc1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C20H26N2O3/c1-21(17-9-14-11-18(23)12-15(14)10-17)20(25)13-4-6-16(7-5-13)22-8-2-3-19(22)24/h4-7,14-15,17-18,23H,2-3,8-12H2,1H3/t14-,15+,17?,18? |
| InChIKey | KEHGTNXRONYZOZ-BXXOZEPKSA-N |
| XLogP | 2.43 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |