C19H23N3O4 — CID 162635550
N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(2,4-dioxoimidazolidin-1-yl)-N-methylbenzamide (PubChem CID 162635550) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(2,4-dioxoimidazolidin-1-yl)-N-methylbenzamide.
| Compound Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(2,4-dioxoimidazolidin-1-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 162635550 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[(3aR,6aS)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-4-(2,4-dioxoimidazolidin-1-yl)-N-methylbenzamide |
| SMILES | CN(C(=O)c1ccc(N2CC(=O)NC2=O)cc1)C1C[C@H]2CC(O)C[C@H]2C1 |
| InChI | InChI=1S/C19H23N3O4/c1-21(15-6-12-8-16(23)9-13(12)7-15)18(25)11-2-4-14(5-3-11)22-10-17(24)20-19(22)26/h2-5,12-13,15-16,23H,6-10H2,1H3,(H,20,24,26)/t12-,13+,15?,16? |
| InChIKey | QSJHASGTWJZSCQ-YPXDRJKUSA-N |
| XLogP | 1.36 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|