C11H19N5O — CID 134704056
3-[[4-[ethyl(methyl)amino]pyrimidin-2-yl]-methylamino]propanamide (PubChem CID 134704056) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-[[4-[ethyl(methyl)amino]pyrimidin-2-yl]-methylamino]propanamide.
| Compound Name | 3-[[4-[ethyl(methyl)amino]pyrimidin-2-yl]-methylamino]propanamide |
|---|---|
| PubChem CID | 134704056 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-[[4-[ethyl(methyl)amino]pyrimidin-2-yl]-methylamino]propanamide |
| SMILES | CCN(C)c1ccnc(N(C)CCC(N)=O)n1 |
| InChI | InChI=1S/C11H19N5O/c1-4-15(2)10-5-7-13-11(14-10)16(3)8-6-9(12)17/h5,7H,4,6,8H2,1-3H3,(H2,12,17) |
| InChIKey | DLGWPAHAKSHRRJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |