C15H19N3O2 — CID 134710020
(3R,4R)-3-(hydroxymethyl)-1-(2-methylquinazolin-4-yl)piperidin-4-ol (PubChem CID 134710020) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is (3R,4R)-3-(hydroxymethyl)-1-(2-methylquinazolin-4-yl)piperidin-4-ol.
| Compound Name | (3R,4R)-3-(hydroxymethyl)-1-(2-methylquinazolin-4-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 134710020 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (3R,4R)-3-(hydroxymethyl)-1-(2-methylquinazolin-4-yl)piperidin-4-ol |
| SMILES | Cc1nc(N2CC[C@@H](O)[C@@H](CO)C2)c2ccccc2n1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-16-13-5-3-2-4-12(13)15(17-10)18-7-6-14(20)11(8-18)9-19/h2-5,11,14,19-20H,6-9H2,1H3/t11-,14-/m1/s1 |
| InChIKey | AJRPNHTUDKDLQE-BXUZGUMPSA-N |
| XLogP | 1.12 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |