C16H23NO3 — CID 134712177
[(2R,6S)-2-butyl-6-cyclopropylmorpholin-4-yl]-(furan-3-yl)methanone (PubChem CID 134712177) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is [(2R,6S)-2-butyl-6-cyclopropylmorpholin-4-yl]-(furan-3-yl)methanone.
| Compound Name | [(2R,6S)-2-butyl-6-cyclopropylmorpholin-4-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 134712177 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | [(2R,6S)-2-butyl-6-cyclopropylmorpholin-4-yl]-(furan-3-yl)methanone |
| SMILES | CCCC[C@@H]1CN(C(=O)c2ccoc2)C[C@H](C2CC2)O1 |
| InChI | InChI=1S/C16H23NO3/c1-2-3-4-14-9-17(10-15(20-14)12-5-6-12)16(18)13-7-8-19-11-13/h7-8,11-12,14-15H,2-6,9-10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | QAEIVBWACOZAPR-HUUCEWRRSA-N |
| XLogP | 3.09 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |