C10H18O2 — CID 13471388
4-methyl-2-[(E)-pent-1-enyl]-1,3-dioxane (PubChem CID 13471388) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is 4-methyl-2-[(E)-pent-1-enyl]-1,3-dioxane.
| Compound Name | 4-methyl-2-[(E)-pent-1-enyl]-1,3-dioxane |
|---|---|
| PubChem CID | 13471388 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | 4-methyl-2-[(E)-pent-1-enyl]-1,3-dioxane |
| SMILES | CCC/C=C/C1OCCC(C)O1 |
| InChI | InChI=1S/C10H18O2/c1-3-4-5-6-10-11-8-7-9(2)12-10/h5-6,9-10H,3-4,7-8H2,1-2H3/b6-5+ |
| InChIKey | ZPMQDOUFYGGEPN-AATRIKPKSA-N |
| XLogP | 2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|