About bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate
bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate (PubChem CID 134716455) has the molecular formula C20H26N4O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate.
Molecular Properties
| Compound Name | bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate |
| PubChem CID | 134716455 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate |
| SMILES | CCc1[nH]cc[n+]1C.CCc1[nH]cc[n+]1C.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C6H10N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-3-6-7-4-5-8(6)2/h1-4H,(H,9,10)(H,11,12);2*4-5H,3H2,1-2H3 |
| InChIKey | YBWYOLPHQDFBFJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate?
The IUPAC name of bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate (CID 134716455) is bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate.
What is the SMILES notation for bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate?
The canonical SMILES for bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate is CCc1[nH]cc[n+]1C.CCc1[nH]cc[n+]1C.O=C([O-])c1ccccc1C(=O)[O-].
What is the InChIKey of bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate?
The InChIKey is YBWYOLPHQDFBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C6H10N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-3-6-7-4-5-8(6)2/h1-4H,(H,9,10)(H,11,12);2*4-5H,3H2,1-2H3.
What are the key properties of bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate?
bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate has a molecular weight of 386.45 g/mol, XLogP of -0.78, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate is sourced from PubChem (CID 134716455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).