C20H26N4O4 — CID 134716455
bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate (PubChem CID 134716455) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate.
| Compound Name | bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate |
|---|---|
| PubChem CID | 134716455 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | bis(2-ethyl-3-methyl-1H-imidazol-3-ium);phthalate |
| SMILES | CCc1[nH]cc[n+]1C.CCc1[nH]cc[n+]1C.O=C([O-])c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H6O4.2C6H10N2/c9-7(10)5-3-1-2-4-6(5)8(11)12;2*1-3-6-7-4-5-8(6)2/h1-4H,(H,9,10)(H,11,12);2*4-5H,3H2,1-2H3 |
| InChIKey | YBWYOLPHQDFBFJ-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|