C16H13BrFNO2 — CID 134717207
(E)-3-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 134717207) has the molecular formula C16H13BrFNO2 and a molecular weight of 350.19 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134717207 |
| Molecular Formula | C16H13BrFNO2 |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (E)-3-[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cc(Br)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H13BrFNO2/c17-13-4-7-15(12(9-13)3-8-16(19)20)21-10-11-1-5-14(18)6-2-11/h1-9H,10H2,(H2,19,20)/b8-3+ |
| InChIKey | ZBKZDZQONHZTPR-FPYGCLRLSA-N |
| XLogP | 3.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|