C46H76NO10P — CID 134717457
(2S)-2-amino-3-[[(2R)-3-[(4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134717457) has the molecular formula C46H76NO10P and a molecular weight of 834.09 g/mol. Its IUPAC name is (2S)-2-amino-3-[[(2R)-3-[(4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[(2R)-3-[(4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134717457 |
| Molecular Formula | C46H76NO10P |
| Molecular Weight | 834.09 g/mol |
| Exact Mass | 833.52 |
| IUPAC Name | (2S)-2-amino-3-[[(2R)-3-[(4E,7E,10E,13E,16E,19E)-docosa-4,7,10,13,16,19-hexaenoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCCCC/C=C/CCCCCC |
| InChI | InChI=1S/C46H76NO10P/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-25-27-29-31-33-35-37-44(48)54-39-42(40-55-58(52,53)56-41-43(47)46(50)51)57-45(49)38-36-34-32-30-28-26-23-18-16-14-12-10-8-6-4-2/h5,7,11,13-14,16-17,19,21-22,25,27,31,33,42-43H,3-4,6,8-10,12,15,18,20,23-24,26,28-30,32,34-41,47H2,1-2H3,(H,50,51)(H,52,53)/b7-5+,13-11+,16-14+,19-17+,22-21+,27-25+,33-31+/t42-,43+/m1/s1 |
| InChIKey | AAUAVBQQEXAMKS-LMAXJSPJSA-N |
| XLogP | 11.50 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.09 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|