C43H74NO10P — CID 138168129
2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 138168129) has the molecular formula C43H74NO10P and a molecular weight of 796.04 g/mol. Its IUPAC name is 2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 138168129 |
| Molecular Formula | C43H74NO10P |
| Molecular Weight | 796.04 g/mol |
| Exact Mass | 795.51 |
| IUPAC Name | 2-amino-3-[[3-[(Z)-henicos-11-enoyl]oxy-2-[(4Z,7Z,10Z,13Z)-hexadeca-4,7,10,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCCCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C43H74NO10P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-24-26-28-30-32-34-41(45)51-36-39(37-52-55(49,50)53-38-40(44)43(47)48)54-42(46)35-33-31-29-27-25-22-16-14-12-10-8-6-4-2/h6,8,12,14,18-19,22,25,29,31,39-40H,3-5,7,9-11,13,15-17,20-21,23-24,26-28,30,32-38,44H2,1-2H3,(H,47,48)(H,49,50)/b8-6-,14-12-,19-18-,25-22-,31-29- |
| InChIKey | HGIXNSYXKSIGAJ-ZZXYYALNSA-N |
| XLogP | 10.78 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.04 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|