C44H81NO7 — CID 134717812
4-[3-[(E)-hexadec-7-enoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134717812) has the molecular formula C44H81NO7 and a molecular weight of 736.13 g/mol. Its IUPAC name is 4-[3-[(E)-hexadec-7-enoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[3-[(E)-hexadec-7-enoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134717812 |
| Molecular Formula | C44H81NO7 |
| Molecular Weight | 736.13 g/mol |
| Exact Mass | 735.60 |
| IUPAC Name | 4-[3-[(E)-hexadec-7-enoyl]oxy-2-[(E)-octadec-11-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C44H81NO7/c1-6-8-10-12-14-16-18-20-21-23-25-27-29-31-33-35-43(47)52-40(38-50-37-36-41(44(48)49)45(3,4)5)39-51-42(46)34-32-30-28-26-24-22-19-17-15-13-11-9-7-2/h16,18,22,24,40-41H,6-15,17,19-21,23,25-39H2,1-5H3/b18-16+,24-22+ |
| InChIKey | AEBZIAYFGLLPMT-NMAHGJMWSA-N |
| XLogP | 9.97 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.13 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|