C50H93NO7 — CID 134780493
4-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134780493) has the molecular formula C50H93NO7 and a molecular weight of 820.29 g/mol. Its IUPAC name is 4-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134780493 |
| Molecular Formula | C50H93NO7 |
| Molecular Weight | 820.29 g/mol |
| Exact Mass | 819.70 |
| IUPAC Name | 4-[2,3-bis[[(E)-icos-11-enoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C50H93NO7/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-48(52)57-45-46(44-56-43-42-47(50(54)55)51(3,4)5)58-49(53)41-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h20-23,46-47H,6-19,24-45H2,1-5H3/b22-20+,23-21+ |
| InChIKey | YAEBZCQZNKGITO-DQPVQCHKSA-N |
| XLogP | 12.31 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.29 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|