C46H85NO7 — CID 138142651
4-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 138142651) has the molecular formula C46H85NO7 and a molecular weight of 764.19 g/mol. Its IUPAC name is 4-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 138142651 |
| Molecular Formula | C46H85NO7 |
| Molecular Weight | 764.19 g/mol |
| Exact Mass | 763.63 |
| IUPAC Name | 4-[2-[(Z)-henicos-11-enoyl]oxy-3-[(Z)-pentadec-9-enoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\CCCCCCCCC |
| InChI | InChI=1S/C46H85NO7/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-27-29-31-33-35-37-45(49)54-42(40-52-39-38-43(46(50)51)47(3,4)5)41-53-44(48)36-34-32-30-28-26-19-17-15-13-11-9-7-2/h15,17,21-22,42-43H,6-14,16,18-20,23-41H2,1-5H3/b17-15-,22-21- |
| InChIKey | DFEJXEMMAPOMIR-RDTMPOLESA-N |
| XLogP | 10.75 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.19 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|