C37H60NO8P — CID 134717911
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate (PubChem CID 134717911) has the molecular formula C37H60NO8P and a molecular weight of 677.86 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 134717911 |
| Molecular Formula | C37H60NO8P |
| Molecular Weight | 677.86 g/mol |
| Exact Mass | 677.41 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCCCCCC/C=C/C=C/C=C/CC |
| InChI | InChI=1S/C37H60NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-36(39)43-33-35(34-45-47(41,42)44-32-31-38)46-37(40)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-17,19,35H,3-4,18,20-34,38H2,1-2H3,(H,41,42)/b7-5+,8-6+,11-9+,12-10+,15-13+,16-14+,19-17+ |
| InChIKey | AFAZWEWDHUEKTA-VDFZJUKXSA-N |
| XLogP | 8.93 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.86 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|