C32H56NO8P — CID 134775395
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-undecanoyloxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate (PubChem CID 134775395) has the molecular formula C32H56NO8P and a molecular weight of 613.77 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-undecanoyloxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-undecanoyloxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 134775395 |
| Molecular Formula | C32H56NO8P |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-undecanoyloxypropan-2-yl] (7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C32H56NO8P/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-32(35)41-30(29-40-42(36,37)39-27-26-33)28-38-31(34)24-22-20-18-12-10-8-6-4-2/h5,7,9,11,13-16,30H,3-4,6,8,10,12,17-29,33H2,1-2H3,(H,36,37)/b7-5+,11-9+,14-13+,16-15+ |
| InChIKey | WDGXJQJGAAXNCD-GXCAUFORSA-N |
| XLogP | 7.65 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|