C42H70NO8P — CID 134751305
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate (PubChem CID 134751305) has the molecular formula C42H70NO8P and a molecular weight of 748.00 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate |
|---|---|
| PubChem CID | 134751305 |
| Molecular Formula | C42H70NO8P |
| Molecular Weight | 748.00 g/mol |
| Exact Mass | 747.48 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (9E,11E,13E)-henicosa-9,11,13-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C/C=C/C=C/CCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C42H70NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-24-26-28-30-32-34-41(44)48-38-40(39-50-52(46,47)49-37-36-43)51-42(45)35-33-31-29-27-25-22-16-14-12-10-8-6-4-2/h6,8,10,12,14-22,25,40H,3-5,7,9,11,13,23-24,26-39,43H2,1-2H3,(H,46,47)/b8-6+,12-10+,16-14+,17-15+,19-18+,21-20+,25-22+ |
| InChIKey | MYISGHKEIBUJJF-HGPQJFTOSA-N |
| XLogP | 10.88 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.00 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|