C41H70NO8P — CID 134732164
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (E)-icos-11-enoate (PubChem CID 134732164) has the molecular formula C41H70NO8P and a molecular weight of 735.98 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (E)-icos-11-enoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (E)-icos-11-enoate |
|---|---|
| PubChem CID | 134732164 |
| Molecular Formula | C41H70NO8P |
| Molecular Weight | 735.98 g/mol |
| Exact Mass | 735.48 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (E)-icos-11-enoate |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/CCCC(=O)OC(COC(=O)CCCCCCCCC/C=C/CCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H70NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-22-23-25-27-29-31-33-40(43)47-37-39(38-49-51(45,46)48-36-35-42)50-41(44)34-32-30-28-26-24-21-16-14-12-10-8-6-4-2/h6,8,10,12,14,16-18,21,24,26,28,39H,3-5,7,9,11,13,15,19-20,22-23,25,27,29-38,42H2,1-2H3,(H,45,46)/b8-6+,12-10+,16-14+,18-17+,24-21+,28-26+ |
| InChIKey | GFBIPJAGHOHKHN-LZUARLRNSA-N |
| XLogP | 10.71 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.98 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|