C52H88NO7+ — CID 134719288
[1-carboxy-3-[2-[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy-3-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134719288) has the molecular formula C52H88NO7+ and a molecular weight of 839.28 g/mol. Its IUPAC name is [1-carboxy-3-[2-[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy-3-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[2-[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy-3-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134719288 |
| Molecular Formula | C52H88NO7+ |
| Molecular Weight | 839.28 g/mol |
| Exact Mass | 838.66 |
| IUPAC Name | [1-carboxy-3-[2-[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy-3-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C52H87NO7/c1-6-8-10-12-14-16-18-20-22-24-25-26-27-29-30-32-34-36-38-40-42-50(54)59-47-48(46-58-45-44-49(52(56)57)53(3,4)5)60-51(55)43-41-39-37-35-33-31-28-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-23,25-26,48-49H,6-7,12-13,18-19,24,27-47H2,1-5H3/p+1/b10-8+,11-9+,16-14+,17-15+,22-20+,23-21+,26-25+ |
| InChIKey | ARSSVLGNPSSUIX-QIXUKNHASA-O |
| XLogP | 13.30 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.28 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|