C48H80NO7+ — CID 134775954
[1-carboxy-3-[3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-2-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134775954) has the molecular formula C48H80NO7+ and a molecular weight of 783.17 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-2-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-2-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134775954 |
| Molecular Formula | C48H80NO7+ |
| Molecular Weight | 783.17 g/mol |
| Exact Mass | 782.59 |
| IUPAC Name | [1-carboxy-3-[3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxy-2-[(11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCCC(=O)OC(COCCC(C(=O)O)[N+](C)(C)C)COC(=O)CCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C48H79NO7/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-29-31-33-35-37-39-47(51)56-44(42-54-41-40-45(48(52)53)49(3,4)5)43-55-46(50)38-36-34-32-30-28-19-17-15-13-11-9-7-2/h8-11,14-17,20-21,23-24,28,30,44-45H,6-7,12-13,18-19,22,25-27,29,31-43H2,1-5H3/p+1/b10-8+,11-9+,16-14+,17-15+,21-20+,24-23+,30-28+ |
| InChIKey | WIPQBKQGBBHOFT-NGSRSBAUSA-O |
| XLogP | 11.74 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.17 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|