C42H72NO7+ — CID 134726216
[1-carboxy-3-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]propyl]-trimethylazanium (PubChem CID 134726216) has the molecular formula C42H72NO7+ and a molecular weight of 703.04 g/mol. Its IUPAC name is [1-carboxy-3-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]propyl]-trimethylazanium.
| Compound Name | [1-carboxy-3-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 134726216 |
| Molecular Formula | C42H72NO7+ |
| Molecular Weight | 703.04 g/mol |
| Exact Mass | 702.53 |
| IUPAC Name | [1-carboxy-3-[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]propyl]-trimethylazanium |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCC(=O)OCC(COCCC(C(=O)O)[N+](C)(C)C)OC(=O)CCCCCCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C42H71NO7/c1-6-8-10-12-14-16-18-20-21-23-24-26-28-30-32-40(44)49-37-38(36-48-35-34-39(42(46)47)43(3,4)5)50-41(45)33-31-29-27-25-22-19-17-15-13-11-9-7-2/h8-11,14-17,20-21,38-39H,6-7,12-13,18-19,22-37H2,1-5H3/p+1/b10-8+,11-9+,16-14+,17-15+,21-20+ |
| InChIKey | DCWWGFFDIILDAH-NZYNXKIGSA-O |
| XLogP | 9.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.04 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|