C49H84O10 — CID 134720689
[(2R)-2-[(E)-octadec-7-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate (PubChem CID 134720689) has the molecular formula C49H84O10 and a molecular weight of 833.20 g/mol. Its IUPAC name is [(2R)-2-[(E)-octadec-7-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate.
| Compound Name | [(2R)-2-[(E)-octadec-7-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
|---|---|
| PubChem CID | 134720689 |
| Molecular Formula | C49H84O10 |
| Molecular Weight | 833.20 g/mol |
| Exact Mass | 832.61 |
| IUPAC Name | [(2R)-2-[(E)-octadec-7-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (7E,10E,13E,16E)-docosa-7,10,13,16-tetraenoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC[C@@H](CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O)OC(=O)CCCCC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C49H84O10/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-25-27-29-31-33-35-37-44(51)56-40-42(41-57-49-48(55)47(54)46(53)43(39-50)59-49)58-45(52)38-36-34-32-30-28-26-23-18-16-14-12-10-8-6-4-2/h11,13,17,19,21-22,25-28,42-43,46-50,53-55H,3-10,12,14-16,18,20,23-24,29-41H2,1-2H3/b13-11+,19-17+,22-21+,27-25+,28-26+/t42-,43-,46+,47?,48?,49-/m0/s1 |
| InChIKey | BEYFQUZTRWLADU-ZBHWBDJZSA-N |
| XLogP | 10.22 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.20 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|