C43H72O10 — CID 134720737
[(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate (PubChem CID 134720737) has the molecular formula C43H72O10 and a molecular weight of 749.04 g/mol. Its IUPAC name is [(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate.
| Compound Name | [(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate |
|---|---|
| PubChem CID | 134720737 |
| Molecular Formula | C43H72O10 |
| Molecular Weight | 749.04 g/mol |
| Exact Mass | 748.51 |
| IUPAC Name | [(2S)-1-[(E)-hexadec-9-enoyl]oxy-3-[(2R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCCC)CO[C@@H]1O[C@H](CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C43H72O10/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-28-30-32-39(46)52-36(35-51-43-42(49)41(48)40(47)37(33-44)53-43)34-50-38(45)31-29-27-25-23-21-19-16-14-12-10-8-6-4-2/h5,7,9,11,13-18,36-37,40-44,47-49H,3-4,6,8,10,12,19-35H2,1-2H3/b7-5+,11-9+,15-13+,16-14+,18-17+/t36-,37-,40+,41?,42?,43-/m1/s1 |
| InChIKey | BFGDRCCLTBIJSP-IDLMYDQTSA-N |
| XLogP | 7.88 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.04 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|