C40H68O10 — CID 134733902
[1-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate (PubChem CID 134733902) has the molecular formula C40H68O10 and a molecular weight of 708.97 g/mol. Its IUPAC name is [1-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate.
| Compound Name | [1-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 134733902 |
| Molecular Formula | C40H68O10 |
| Molecular Weight | 708.97 g/mol |
| Exact Mass | 708.48 |
| IUPAC Name | [1-[(E)-pentadec-9-enoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropan-2-yl] (9E,11E,13E)-hexadeca-9,11,13-trienoate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COC(=O)CCCCCCC/C=C/CCCCC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C40H68O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-36(43)49-33(32-48-40-39(46)38(45)37(44)34(30-41)50-40)31-47-35(42)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,9,11-15,33-34,37-41,44-46H,3-4,6,8,10,16-32H2,1-2H3/b7-5+,11-9+,14-12+,15-13+/t33?,34-,37+,38?,39?,40-/m0/s1 |
| InChIKey | GWDDALRTGPZEPM-QIUNUWIFSA-N |
| XLogP | 6.93 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.97 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|