C43H74O10 — CID 134746440
[2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-octadec-11-enoate (PubChem CID 134746440) has the molecular formula C43H74O10 and a molecular weight of 751.06 g/mol. Its IUPAC name is [2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-octadec-11-enoate.
| Compound Name | [2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-octadec-11-enoate |
|---|---|
| PubChem CID | 134746440 |
| Molecular Formula | C43H74O10 |
| Molecular Weight | 751.06 g/mol |
| Exact Mass | 750.53 |
| IUPAC Name | [2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxy-3-[(2S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypropyl] (E)-octadec-11-enoate |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C/CCCCCC)CO[C@H]1O[C@@H](CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C43H74O10/c1-3-5-7-9-11-13-15-17-18-20-21-23-25-27-29-31-38(45)50-34-36(35-51-43-42(49)41(48)40(47)37(33-44)53-43)52-39(46)32-30-28-26-24-22-19-16-14-12-10-8-6-4-2/h6,8,10,12-16,36-37,40-44,47-49H,3-5,7,9,11,17-35H2,1-2H3/b8-6+,12-10+,15-13+,16-14+/t36?,37-,40+,41?,42?,43-/m0/s1 |
| InChIKey | LGBKVPDVOBMSBN-TVNGSEIFSA-N |
| XLogP | 8.10 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.06 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|