C34H57NO7 — CID 134720902
4-[2,3-bis[[(6E,9E)-dodeca-6,9-dienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134720902) has the molecular formula C34H57NO7 and a molecular weight of 591.83 g/mol. Its IUPAC name is 4-[2,3-bis[[(6E,9E)-dodeca-6,9-dienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2,3-bis[[(6E,9E)-dodeca-6,9-dienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134720902 |
| Molecular Formula | C34H57NO7 |
| Molecular Weight | 591.83 g/mol |
| Exact Mass | 591.41 |
| IUPAC Name | 4-[2,3-bis[[(6E,9E)-dodeca-6,9-dienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/CCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C34H57NO7/c1-6-8-10-12-14-16-18-20-22-24-32(36)41-29-30(28-40-27-26-31(34(38)39)35(3,4)5)42-33(37)25-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,30-31H,6-7,12-13,18-29H2,1-5H3/b10-8+,11-9+,16-14+,17-15+ |
| InChIKey | BGWPQGUMLNTLHP-SYGKQBLGSA-N |
| XLogP | 5.62 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|