C50H81NO7 — CID 134725586
4-[2-[(7E,10E,13E,16E,19E,22E)-pentacosa-7,10,13,16,19,22-hexaenoyl]oxy-3-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134725586) has the molecular formula C50H81NO7 and a molecular weight of 808.20 g/mol. Its IUPAC name is 4-[2-[(7E,10E,13E,16E,19E,22E)-pentacosa-7,10,13,16,19,22-hexaenoyl]oxy-3-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2-[(7E,10E,13E,16E,19E,22E)-pentacosa-7,10,13,16,19,22-hexaenoyl]oxy-3-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134725586 |
| Molecular Formula | C50H81NO7 |
| Molecular Weight | 808.20 g/mol |
| Exact Mass | 807.60 |
| IUPAC Name | 4-[2-[(7E,10E,13E,16E,19E,22E)-pentacosa-7,10,13,16,19,22-hexaenoyl]oxy-3-[(9E,12E)-pentadeca-9,12-dienoyl]oxypropoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCCCC(=O)OC(COCCC(C(=O)[O-])[N+](C)(C)C)COC(=O)CCCCCCC/C=C/C/C=C/CC |
| InChI | InChI=1S/C50H81NO7/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-27-28-29-31-33-35-37-39-41-49(53)58-46(44-56-43-42-47(50(54)55)51(3,4)5)45-57-48(52)40-38-36-34-32-30-19-17-15-13-11-9-7-2/h8-11,14-17,20-21,23-24,26-27,29,31,46-47H,6-7,12-13,18-19,22,25,28,30,32-45H2,1-5H3/b10-8+,11-9+,16-14+,17-15+,21-20+,24-23+,27-26+,31-29+ |
| InChIKey | CXJCHDYBDGKKNH-XLLVEMGESA-N |
| XLogP | 10.96 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.20 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|