C43H70NO10P — CID 134727117
(2R)-2-amino-3-[[3-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134727117) has the molecular formula C43H70NO10P and a molecular weight of 792.00 g/mol. Its IUPAC name is (2R)-2-amino-3-[[3-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[[3-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134727117 |
| Molecular Formula | C43H70NO10P |
| Molecular Weight | 792.00 g/mol |
| Exact Mass | 791.47 |
| IUPAC Name | (2R)-2-amino-3-[[3-[(9E,11E,13E)-henicosa-9,11,13-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCCC/C=C/C=C/C=C/CCCCCCC)COP(=O)(O)OC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C43H70NO10P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-24-26-28-30-32-34-41(45)51-36-39(37-52-55(49,50)53-38-40(44)43(47)48)54-42(46)35-33-31-29-27-25-22-16-14-12-10-8-6-4-2/h6,8,10,12,14-22,25,39-40H,3-5,7,9,11,13,23-24,26-38,44H2,1-2H3,(H,47,48)(H,49,50)/b8-6+,12-10+,16-14+,17-15+,19-18+,21-20+,25-22+/t39?,40-/m1/s1 |
| InChIKey | DLONUGULBUNJOD-GYMAKLINSA-N |
| XLogP | 10.33 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.00 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|