C44H76NO10P — CID 134730720
(2R)-2-amino-3-[[3-[(E)-docos-11-enoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134730720) has the molecular formula C44H76NO10P and a molecular weight of 810.06 g/mol. Its IUPAC name is (2R)-2-amino-3-[[3-[(E)-docos-11-enoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[[3-[(E)-docos-11-enoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134730720 |
| Molecular Formula | C44H76NO10P |
| Molecular Weight | 810.06 g/mol |
| Exact Mass | 809.52 |
| IUPAC Name | (2R)-2-amino-3-[[3-[(E)-docos-11-enoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C/CCCCCCCCCC)COP(=O)(O)OC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C44H76NO10P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-24-25-27-29-31-33-35-42(46)52-37-40(38-53-56(50,51)54-39-41(45)44(48)49)55-43(47)36-34-32-30-28-26-23-16-14-12-10-8-6-4-2/h6,8,10,12,14,16,19-20,23,26,40-41H,3-5,7,9,11,13,15,17-18,21-22,24-25,27-39,45H2,1-2H3,(H,48,49)(H,50,51)/b8-6+,12-10+,16-14+,20-19+,26-23+/t40?,41-/m1/s1 |
| InChIKey | FSPIQHBNOMMZNC-REFHLTMASA-N |
| XLogP | 11.17 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.06 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|