C42H72NO10P — CID 134775689
(2S)-2-amino-3-[hydroxy-[(2R)-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxy-2-[(E)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid (PubChem CID 134775689) has the molecular formula C42H72NO10P and a molecular weight of 782.01 g/mol. Its IUPAC name is (2S)-2-amino-3-[hydroxy-[(2R)-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxy-2-[(E)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxy-2-[(E)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134775689 |
| Molecular Formula | C42H72NO10P |
| Molecular Weight | 782.01 g/mol |
| Exact Mass | 781.49 |
| IUPAC Name | (2S)-2-amino-3-[hydroxy-[(2R)-3-[(9E,11E,13E,15E)-octadeca-9,11,13,15-tetraenoyl]oxy-2-[(E)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C42H72NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-40(44)50-35-38(36-51-54(48,49)52-37-39(43)42(46)47)53-41(45)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5,7,9,11,13,15,17-20,38-39H,3-4,6,8,10,12,14,16,21-37,43H2,1-2H3,(H,46,47)(H,48,49)/b7-5+,11-9+,15-13+,19-17+,20-18+/t38-,39+/m1/s1 |
| InChIKey | WGBMTDCUGYNORL-NLCBACJWSA-N |
| XLogP | 10.39 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.01 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|