C48H81NO7 — CID 134730364
4-[2,3-bis[[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate (PubChem CID 134730364) has the molecular formula C48H81NO7 and a molecular weight of 784.18 g/mol. Its IUPAC name is 4-[2,3-bis[[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate.
| Compound Name | 4-[2,3-bis[[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 134730364 |
| Molecular Formula | C48H81NO7 |
| Molecular Weight | 784.18 g/mol |
| Exact Mass | 783.60 |
| IUPAC Name | 4-[2,3-bis[[(10E,13E,16E)-nonadeca-10,13,16-trienoyl]oxy]propoxy]-2-(trimethylazaniumyl)butanoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCCC(=O)OCC(COCCC(C(=O)[O-])[N+](C)(C)C)OC(=O)CCCCCCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C48H81NO7/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-46(50)55-43-44(42-54-41-40-45(48(52)53)49(3,4)5)56-47(51)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h8-11,14-17,20-23,44-45H,6-7,12-13,18-19,24-43H2,1-5H3/b10-8+,11-9+,16-14+,17-15+,22-20+,23-21+ |
| InChIKey | FPANWQRQBGAAEK-USDQEQGNSA-N |
| XLogP | 10.63 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.18 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|