C39H62NO10P — CID 134734867
(2S)-2-amino-3-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134734867) has the molecular formula C39H62NO10P and a molecular weight of 735.90 g/mol. Its IUPAC name is (2S)-2-amino-3-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134734867 |
| Molecular Formula | C39H62NO10P |
| Molecular Weight | 735.90 g/mol |
| Exact Mass | 735.41 |
| IUPAC Name | (2S)-2-amino-3-[[3-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCC/C=C/C/C=C/C/C=C/CC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C39H62NO10P/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-37(41)47-32-35(33-48-51(45,46)49-34-36(40)39(43)44)50-38(42)31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h5-8,10-14,16-19,21,35-36H,3-4,9,15,20,22-34,40H2,1-2H3,(H,43,44)(H,45,46)/b7-5+,8-6+,12-10+,13-11+,16-14+,19-17+,21-18+/t35?,36-/m0/s1 |
| InChIKey | HEWUEUKHSCXTBX-XCIHCDLZSA-N |
| XLogP | 8.77 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.90 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|