C36H56NO10P — CID 134764429
(2S)-2-amino-3-[[2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(5E,8E,11E)-tetradeca-5,8,11-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134764429) has the molecular formula C36H56NO10P and a molecular weight of 693.82 g/mol. Its IUPAC name is (2S)-2-amino-3-[[2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(5E,8E,11E)-tetradeca-5,8,11-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(5E,8E,11E)-tetradeca-5,8,11-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134764429 |
| Molecular Formula | C36H56NO10P |
| Molecular Weight | 693.82 g/mol |
| Exact Mass | 693.36 |
| IUPAC Name | (2S)-2-amino-3-[[2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxy-3-[(5E,8E,11E)-tetradeca-5,8,11-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCC/C=C/C/C=C/C/C=C/CC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C36H56NO10P/c1-3-5-7-9-11-13-15-16-18-20-22-24-26-28-35(39)47-32(30-45-48(42,43)46-31-33(37)36(40)41)29-44-34(38)27-25-23-21-19-17-14-12-10-8-6-4-2/h5-9,11-16,18-19,21,32-33H,3-4,10,17,20,22-31,37H2,1-2H3,(H,40,41)(H,42,43)/b7-5+,8-6+,11-9+,14-12+,15-13+,18-16+,21-19+/t32?,33-/m0/s1 |
| InChIKey | RNILAEIUJOWNDN-QIVJKBHPSA-N |
| XLogP | 7.60 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.82 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|