C32H52NO10P — CID 134737395
(2S)-2-amino-3-[[3-[(4E,7E)-deca-4,7-dienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 134737395) has the molecular formula C32H52NO10P and a molecular weight of 641.74 g/mol. Its IUPAC name is (2S)-2-amino-3-[[3-[(4E,7E)-deca-4,7-dienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | (2S)-2-amino-3-[[3-[(4E,7E)-deca-4,7-dienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 134737395 |
| Molecular Formula | C32H52NO10P |
| Molecular Weight | 641.74 g/mol |
| Exact Mass | 641.33 |
| IUPAC Name | (2S)-2-amino-3-[[3-[(4E,7E)-deca-4,7-dienoyl]oxy-2-[(9E,11E,13E)-hexadeca-9,11,13-trienoyl]oxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C/C=C/C=C/CCCCCCCC(=O)OC(COC(=O)CC/C=C/C/C=C/CC)COP(=O)(O)OC[C@H](N)C(=O)O |
| InChI | InChI=1S/C32H52NO10P/c1-3-5-7-9-11-12-13-14-15-16-18-20-22-24-31(35)43-28(26-41-44(38,39)42-27-29(33)32(36)37)25-40-30(34)23-21-19-17-10-8-6-4-2/h5-9,11-13,17,19,28-29H,3-4,10,14-16,18,20-27,33H2,1-2H3,(H,36,37)(H,38,39)/b7-5+,8-6+,11-9+,13-12+,19-17+/t28?,29-/m0/s1 |
| InChIKey | ICABOPDRQSGDRA-IGSAALHKSA-N |
| XLogP | 6.49 |
| TPSA | 171.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|