C37H60O4 — CID 134741217
7-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypentadecanoic acid (PubChem CID 134741217) has the molecular formula C37H60O4 and a molecular weight of 568.88 g/mol. Its IUPAC name is 7-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypentadecanoic acid.
| Compound Name | 7-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypentadecanoic acid |
|---|---|
| PubChem CID | 134741217 |
| Molecular Formula | C37H60O4 |
| Molecular Weight | 568.88 g/mol |
| Exact Mass | 568.45 |
| IUPAC Name | 7-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxypentadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(CCCCCCCC)CCCCCC(=O)O |
| InChI | InChI=1S/C37H60O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-25-30-34-37(40)41-35(31-27-24-10-8-6-4-2)32-28-26-29-33-36(38)39/h5,7,11-12,14-15,17-18,20-21,23,25,35H,3-4,6,8-10,13,16,19,22,24,26-34H2,1-2H3,(H,38,39)/b7-5-,12-11-,15-14-,18-17-,21-20-,25-23- |
| InChIKey | JKBKGICRQYMXHJ-ZHGRDZPSSA-N |
| XLogP | 11.16 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.88 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|