C38H62O4 — CID 134758426
11-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexadecanoic acid (PubChem CID 134758426) has the molecular formula C38H62O4 and a molecular weight of 582.91 g/mol. Its IUPAC name is 11-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexadecanoic acid.
| Compound Name | 11-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexadecanoic acid |
|---|---|
| PubChem CID | 134758426 |
| Molecular Formula | C38H62O4 |
| Molecular Weight | 582.91 g/mol |
| Exact Mass | 582.46 |
| IUPAC Name | 11-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyhexadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(CCCCC)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C38H62O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-27-31-35-38(41)42-36(32-28-6-4-2)33-29-25-22-21-23-26-30-34-37(39)40/h5,7,9-10,12-13,15-16,18-19,24,27,36H,3-4,6,8,11,14,17,20-23,25-26,28-35H2,1-2H3,(H,39,40)/b7-5-,10-9-,13-12-,16-15-,19-18-,27-24- |
| InChIKey | PLQJBJDAOIHSLL-VLDPFNONSA-N |
| XLogP | 11.55 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.91 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|