C40H66O4 — CID 134786007
10-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyoctadecanoic acid (PubChem CID 134786007) has the molecular formula C40H66O4 and a molecular weight of 610.96 g/mol. Its IUPAC name is 10-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyoctadecanoic acid.
| Compound Name | 10-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyoctadecanoic acid |
|---|---|
| PubChem CID | 134786007 |
| Molecular Formula | C40H66O4 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.50 |
| IUPAC Name | 10-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]oxyoctadecanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(CCCCCCCC)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C40H66O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-23-29-33-37-40(43)44-38(34-30-26-10-8-6-4-2)35-31-27-24-25-28-32-36-39(41)42/h5,7,11-12,14-15,17-18,20-21,23,29,38H,3-4,6,8-10,13,16,19,22,24-28,30-37H2,1-2H3,(H,41,42)/b7-5-,12-11-,15-14-,18-17-,21-20-,29-23- |
| InChIKey | ZYBSJTAYWATPEZ-JGHKAWMUSA-N |
| XLogP | 12.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|