C46H80NO8P — CID 134742226
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,14E)-pentacosa-11,14-dienoate (PubChem CID 134742226) has the molecular formula C46H80NO8P and a molecular weight of 806.12 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,14E)-pentacosa-11,14-dienoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,14E)-pentacosa-11,14-dienoate |
|---|---|
| PubChem CID | 134742226 |
| Molecular Formula | C46H80NO8P |
| Molecular Weight | 806.12 g/mol |
| Exact Mass | 805.56 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,14E)-pentacosa-11,14-dienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCCCCC/C=C/C/C=C/CCCCCCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C46H80NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-27-28-30-32-34-36-38-45(48)52-42-44(43-54-56(50,51)53-41-40-47)55-46(49)39-37-35-33-31-29-26-16-14-12-10-8-6-4-2/h6,8,10,12,14,16,19-20,22-23,26,29,44H,3-5,7,9,11,13,15,17-18,21,24-25,27-28,30-43,47H2,1-2H3,(H,50,51)/b8-6+,12-10+,16-14+,20-19+,23-22+,29-26+ |
| InChIKey | JSQDHLGCAJJZIT-CZRMKLQGSA-N |
| XLogP | 12.66 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.12 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|