C40H66NO8P — CID 134721004
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (10E,13E,16E)-nonadeca-10,13,16-trienoate (PubChem CID 134721004) has the molecular formula C40H66NO8P and a molecular weight of 719.94 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (10E,13E,16E)-nonadeca-10,13,16-trienoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (10E,13E,16E)-nonadeca-10,13,16-trienoate |
|---|---|
| PubChem CID | 134721004 |
| Molecular Formula | C40H66NO8P |
| Molecular Weight | 719.94 g/mol |
| Exact Mass | 719.45 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (10E,13E,16E)-nonadeca-10,13,16-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OC(COC(=O)CCCCCCCC/C=C/C/C=C/C/C=C/CC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C40H66NO8P/c1-3-5-7-9-11-13-15-17-18-19-21-22-24-26-28-30-32-39(42)46-36-38(37-48-50(44,45)47-35-34-41)49-40(43)33-31-29-27-25-23-20-16-14-12-10-8-6-4-2/h5-8,10-14,16-18,20,23,38H,3-4,9,15,19,21-22,24-37,41H2,1-2H3,(H,44,45)/b7-5+,8-6+,12-10+,13-11+,16-14+,18-17+,23-20+ |
| InChIKey | BHWGAFOSBGMZPC-VOTZARKESA-N |
| XLogP | 10.10 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.94 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|