C44H70NO8P — CID 134737778
[3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoate (PubChem CID 134737778) has the molecular formula C44H70NO8P and a molecular weight of 772.02 g/mol. Its IUPAC name is [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoate.
| Compound Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoate |
|---|---|
| PubChem CID | 134737778 |
| Molecular Formula | C44H70NO8P |
| Molecular Weight | 772.02 g/mol |
| Exact Mass | 771.48 |
| IUPAC Name | [3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[(5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoyl]oxypropyl] (11E,14E,17E,20E)-tricosa-11,14,17,20-tetraenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/CCCC(=O)OC(COC(=O)CCCCCCCCC/C=C/C/C=C/C/C=C/C/C=C/CC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C44H70NO8P/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-25-26-28-30-32-34-36-43(46)50-40-42(41-52-54(48,49)51-39-38-45)53-44(47)37-35-33-31-29-27-24-16-14-12-10-8-6-4-2/h5-8,10-14,16-18,20-21,24,27,29,31,42H,3-4,9,15,19,22-23,25-26,28,30,32-41,45H2,1-2H3,(H,48,49)/b7-5+,8-6+,12-10+,13-11+,16-14+,18-17+,21-20+,27-24+,31-29+ |
| InChIKey | IFDXOIYLIBQHST-WFXVFDSESA-N |
| XLogP | 11.21 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.02 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|