C36H56NO8P — CID 134771839
[1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxypropan-2-yl] (5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoate (PubChem CID 134771839) has the molecular formula C36H56NO8P and a molecular weight of 661.82 g/mol. Its IUPAC name is [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxypropan-2-yl] (5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoate.
| Compound Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxypropan-2-yl] (5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoate |
|---|---|
| PubChem CID | 134771839 |
| Molecular Formula | C36H56NO8P |
| Molecular Weight | 661.82 g/mol |
| Exact Mass | 661.37 |
| IUPAC Name | [1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(6E,9E,12E)-pentadeca-6,9,12-trienoyl]oxypropan-2-yl] (5E,7E,9E,11E,13E)-hexadeca-5,7,9,11,13-pentaenoate |
| SMILES | CC/C=C/C=C/C=C/C=C/C=C/CCCC(=O)OC(COC(=O)CCCC/C=C/C/C=C/C/C=C/CC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C36H56NO8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-36(39)45-34(33-44-46(40,41)43-31-30-37)32-42-35(38)28-26-24-22-20-18-16-14-12-10-8-6-4-2/h5-9,11-15,17-21,23,34H,3-4,10,16,22,24-33,37H2,1-2H3,(H,40,41)/b7-5+,8-6+,11-9+,14-12+,15-13+,19-17+,20-18+,23-21+ |
| InChIKey | UVTMOQKKBRQFEI-IVBQCGMHSA-N |
| XLogP | 8.31 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.82 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|